CymitQuimica logo

CAS 10385-36-1

:

2,3,4-(Trimethoxy)bromobenzene

Description:
2,3,4-(Trimethoxy)bromobenzene, with the CAS number 10385-36-1, is an organic compound characterized by the presence of a bromine atom and three methoxy groups (-OCH3) attached to a benzene ring. The methoxy groups are located at the 2, 3, and 4 positions relative to the bromine substituent, which influences the compound's reactivity and solubility. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to the electron-donating properties of the methoxy groups that can enhance nucleophilicity. Additionally, the presence of bromine makes it a useful intermediate in various chemical reactions, including cross-coupling reactions. The compound's physical properties, such as boiling point and melting point, can vary based on its specific structure and purity. Safety precautions should be taken when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C9H11BrO3
InChI:InChI=1/C9H11BrO3/c1-11-7-5-4-6(10)8(12-2)9(7)13-3/h4-5H,1-3H3
InChI key:HKCQJLVIFMFOTG-UHFFFAOYSA-N
SMILES:COc1ccc(c(c1OC)OC)Br
Synonyms:
  • 1-Bromo-2,3,4-Trimethoxybenzene
Found 4 products.