CymitQuimica logo

CAS 10385-50-9

:

a-D-Galactopyranose,2-(acetylamino)-2-deoxy-, 1,3,4,6-tetraacetate

Description:
α-D-Galactopyranose, 2-(acetylamino)-2-deoxy-, 1,3,4,6-tetraacetate, commonly referred to as a derivative of galactose, is a carbohydrate characterized by its pyranose ring structure. This compound features multiple acetyl groups, which enhance its solubility and reactivity. The presence of the acetylamino group at the 2-position indicates that it has been modified to include an amine functional group, contributing to its biological activity and potential applications in medicinal chemistry. The tetraacetate form suggests that all hydroxyl groups on the sugar are acetylated, which can influence its interactions with enzymes and receptors. This compound is typically used in biochemical research, particularly in studies involving glycoproteins and polysaccharides. Its CAS number, 10385-50-9, allows for precise identification in chemical databases. Overall, the structural modifications impart unique properties that can be exploited in various chemical and biological applications.
Formula:C16H23NO10
InChI:InChI=1S/C16H23NO10/c1-7(18)17-13-15(25-10(4)21)14(24-9(3)20)12(6-23-8(2)19)27-16(13)26-11(5)22/h12-16H,6H2,1-5H3,(H,17,18)
InChI key:OVPIZHVSWNOZMN-UHFFFAOYSA-N
SMILES:CC(=O)NC1C(C(C(OC1OC(=O)C)COC(=O)C)OC(=O)C)OC(=O)C
Synonyms:
  • Galactopyranose,2-acetamido-2-deoxy-, 1,3,4,6-tetraacetate, a-D- (8CI)
  • Nsc 231915
Found 5 products.