CymitQuimica logo

CAS 103853-87-8

:

8-Hydroxy-2-methyl-5-quinolinecarboxylic acid

Description:
8-Hydroxy-2-methyl-5-quinolinecarboxylic acid, with the CAS number 103853-87-8, is a chemical compound that belongs to the class of quinoline derivatives. This substance is characterized by the presence of a hydroxyl group (-OH) and a carboxylic acid group (-COOH) attached to a quinoline ring, which contributes to its potential biological activity. It typically appears as a solid and is soluble in polar solvents, reflecting its functional groups. The compound is of interest in various fields, including medicinal chemistry and biochemistry, due to its potential applications as a chelating agent and in the development of pharmaceuticals. Its structure allows for interactions with metal ions, which can be significant in biological systems. Additionally, the presence of the methyl group influences its chemical reactivity and solubility. Overall, 8-Hydroxy-2-methyl-5-quinolinecarboxylic acid is a versatile compound with notable properties that warrant further investigation in scientific research.
Formula:C11H9NO3
InChI:InChI=1S/C11H9NO3/c1-6-2-3-7-8(11(14)15)4-5-9(13)10(7)12-6/h2-5,13H,1H3,(H,14,15)
InChI key:OSIQYUORWIAWMM-UHFFFAOYSA-N
SMILES:CC1=NC2=C(C=CC(=C2C=C1)C(=O)O)O
Synonyms:
  • 8-Hydroxy-2-methylquinoline-5-carboxylic acid
  • 8-Hydroxy-2-methyl-5-quinolinecarboxylic acid
  • 5-Quinolinecarboxylic acid, 8-hydroxy-2-methyl-
Found 3 products.