CymitQuimica logo

CAS 103858-52-2

:

4-Bromoindole-2-carboxylic acid ethyl ester

Description:
4-Bromoindole-2-carboxylic acid ethyl ester is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a bromine atom at the 4-position and an ethyl ester functional group at the 2-carboxylic acid position contributes to its unique chemical properties. This compound typically appears as a solid or liquid, depending on the specific conditions, and is soluble in organic solvents. It is often used in organic synthesis and medicinal chemistry due to its potential biological activity, particularly in the development of pharmaceuticals. The bromine substituent can enhance reactivity in electrophilic aromatic substitution reactions, while the ethyl ester group can be hydrolyzed to yield the corresponding carboxylic acid. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 4-Bromoindole-2-carboxylic acid ethyl ester serves as a valuable intermediate in various chemical applications.
Formula:C11H10BrNO2
InChI:InChI=1/C11H10BrNO2/c1-2-15-11(14)10-6-7-8(12)4-3-5-9(7)13-10/h3-6,13H,2H2,1H3
InChI key:KNPDUPLMXYEJAU-UHFFFAOYSA-N
SMILES:CCOC(=O)c1cc2c(cccc2[nH]1)Br
Synonyms:
  • 1H-indole-2-carboxylic acid, 4-bromo-, ethyl ester
  • Ethyl 4-bromo-1H-indole-2-carboxylate
Found 4 products.