CymitQuimica logo

CAS 103858-55-5

:

1H-Indole-3-carboxylic acid, 6-bromo-, ethyl ester

Description:
1H-Indole-3-carboxylic acid, 6-bromo-, ethyl ester is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a carboxylic acid group and an ethyl ester functional group indicates that it can participate in various chemical reactions, such as esterification and hydrolysis. The bromine substituent at the 6-position of the indole ring introduces unique reactivity and can influence the compound's biological activity. This compound is typically used in organic synthesis and may have applications in medicinal chemistry due to the biological significance of indole derivatives. Its solubility properties are influenced by the ester group, making it more soluble in organic solvents compared to its acid counterpart. Additionally, the compound may exhibit interesting pharmacological properties, which are often explored in drug development. Overall, 1H-Indole-3-carboxylic acid, 6-bromo-, ethyl ester is a versatile compound with potential applications in various fields of chemistry and biology.
Formula:C11H10BrNO2
InChI:InChI=1S/C11H10BrNO2/c1-2-15-11(14)9-6-13-10-5-7(12)3-4-8(9)10/h3-6,13H,2H2,1H3
InChI key:GBTDSENHTMLWAI-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=CNC2=C1C=CC(=C2)Br
Found 5 products.