CymitQuimica logo

CAS 103859-86-5

:

4-(4'-Methoxyphenyl)-2-pyrrolidinone

Description:
4-(4'-Methoxyphenyl)-2-pyrrolidinone, identified by its CAS number 103859-86-5, is an organic compound characterized by its pyrrolidinone structure, which features a five-membered lactam ring. This compound contains a methoxyphenyl group, indicating the presence of a methoxy (-OCH3) substituent on a phenyl ring, which is attached to the pyrrolidinone. The molecular structure suggests that it may exhibit both polar and non-polar characteristics, making it potentially soluble in various organic solvents. The presence of the pyrrolidinone moiety may impart biological activity, as similar compounds are often investigated for their pharmacological properties. Additionally, the methoxy group can influence the compound's electronic properties and reactivity, potentially affecting its interactions in chemical reactions or biological systems. Overall, 4-(4'-Methoxyphenyl)-2-pyrrolidinone is of interest in medicinal chemistry and material science, although specific applications and biological activities would require further investigation.
Formula:C11H13NO2
InChI:InChI=1S/C11H13NO2/c1-14-10-4-2-8(3-5-10)9-6-11(13)12-7-9/h2-5,9H,6-7H2,1H3,(H,12,13)
InChI key:YDVYLFOSWUPISL-UHFFFAOYSA-N
SMILES:COC1=CC=C(C=C1)C2CC(=O)NC2
Found 4 products.