CymitQuimica logo

CAS 103861-77-4

:

2-(3-METHOXYPHENYL)PYRROLIDINE

Description:
2-(3-Methoxyphenyl)pyrrolidine is an organic compound characterized by its pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. The presence of a methoxyphenyl group at the 2-position of the pyrrolidine structure contributes to its unique chemical properties. This compound typically exhibits moderate polarity due to the methoxy group, which can influence its solubility in various solvents. It may participate in hydrogen bonding due to the nitrogen atom in the pyrrolidine ring, affecting its reactivity and interactions with other molecules. The methoxy group can also serve as an electron-donating substituent, potentially impacting the compound's electronic properties and reactivity in chemical reactions. 2-(3-Methoxyphenyl)pyrrolidine may be of interest in medicinal chemistry and pharmacology, as derivatives of pyrrolidine are often explored for their biological activities. However, specific applications and biological effects would depend on further research and characterization. As with any chemical substance, safety data and handling precautions should be consulted before use.
Formula:C11H15NO
InChI:InChI=1/C11H15NO/c1-13-10-5-2-4-9(8-10)11-6-3-7-12-11/h2,4-5,8,11-12H,3,6-7H2,1H3
InChI key:QGKFYRMABWIOIW-UHFFFAOYSA-N
SMILES:COc1cccc(c1)C1CCCN1
Synonyms:
  • Chembrdg-Bb 4002379
  • Akos Bb-8862
Found 5 products.