CAS 103876-99-9
:4-Methoxy-6-[[(6-methoxy-1H-benzimidazol-2-yl)thio]methyl]-5-methyl-3-pyridinemethanol
Description:
4-Methoxy-6-[[(6-methoxy-1H-benzimidazol-2-yl)thio]methyl]-5-methyl-3-pyridinemethanol, with the CAS number 103876-99-9, is a chemical compound that features a complex structure incorporating a pyridine ring, a benzimidazole moiety, and various functional groups such as methoxy and thioether. This compound is characterized by its potential biological activity, often investigated for its pharmacological properties. The presence of the methoxy groups may enhance lipophilicity, influencing its absorption and distribution in biological systems. The thioether linkage can also play a crucial role in the compound's reactivity and interaction with biological targets. Additionally, the compound's structural features suggest it may exhibit specific binding affinities, making it a candidate for further research in medicinal chemistry. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability and solubility would be important factors in its application in research or therapeutic contexts. Overall, this compound represents a class of molecules that could have significant implications in drug development.
Formula:C17H19N3O3S
InChI:InChI=1S/C17H19N3O3S/c1-10-15(18-7-11(8-21)16(10)23-3)9-24-17-19-13-5-4-12(22-2)6-14(13)20-17/h4-7,21H,8-9H2,1-3H3,(H,19,20)
InChI key:InChIKey=KBRHWXYFTPMNSX-UHFFFAOYSA-N
SMILES:S(CC1=C(C)C(OC)=C(CO)C=N1)C=2NC=3C(N2)=CC=C(OC)C3
Synonyms:- 3-Pyridinemethanol, 4-methoxy-6-[[(5-methoxy-1H-benzimidazol-2-yl)thio]methyl]-5-methyl-
- 4-Methoxy-6-[[(6-methoxy-1H-benzimidazol-2-yl)thio]methyl]-5-methyl-3-pyridinemethanol
- 3-Pyridinemethanol, 4-methoxy-6-[[(6-methoxy-1H-benzimidazol-2-yl)thio]methyl]-5-methyl-
- 4-Methoxy-6-[[(5-Methoxy-1H-benziMidazol-2-yl)thio]Methyl]-5-Methyl-3-pyridineMethanol
- [4-methoxy-6-[(6-methoxy-1H-benzimidazol-2-yl)sulfanylmethyl]-5-methylpyridin-3-yl]methanol
- 2[(4-METHOXY-5-HYDROXYMETHYL-3-METHYLPYRID-2-YL)-METHYLTHIO]-5-METHOXYBENZIMIDAZOLE
- 5-Methoxy-2-{[(5-hydroxymethyl-4-methoxy-3-methyl-2-pyridinyl)methyl]thio}-1H-benzimidazole
- 5-Hydroxyomeprazole sulfide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
