CymitQuimica logo

CAS 103877-79-8

:

2-Amino-5-fluoro-4-methylbenzoic acid

Description:
2-Amino-5-fluoro-4-methylbenzoic acid, with the CAS number 103877-79-8, is an aromatic amino acid derivative characterized by the presence of an amino group (-NH2), a fluoro group (-F), and a methyl group (-CH3) attached to a benzoic acid structure. This compound typically exhibits properties associated with both amino acids and aromatic compounds, including potential solubility in polar solvents due to the carboxylic acid functional group. The presence of the fluorine atom can influence its reactivity and biological activity, often enhancing lipophilicity and altering metabolic pathways. The compound may exhibit acidic properties due to the carboxylic acid group, while the amino group can participate in hydrogen bonding, affecting its interactions in biological systems. Additionally, it may serve as a building block in pharmaceutical synthesis or as a research chemical in studies related to drug development, particularly in the context of compounds with potential therapeutic applications. Its specific characteristics, such as melting point, boiling point, and spectral data, would need to be referenced from experimental data or literature for precise applications.
Formula:C8H8FNO2
InChI:InChI=1S/C8H8FNO2/c1-4-2-7(10)5(8(11)12)3-6(4)9/h2-3H,10H2,1H3,(H,11,12)
InChI key:InChIKey=ANSJZFWRKRROGH-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(N)C=C(C)C(F)=C1
Synonyms:
  • 2-Amino-5-fluoro-4-methylbenzoic acid
  • 2-Amino-4-methyl-5-fluoro-benzoic acid
  • Benzoic acid, 2-amino-5-fluoro-4-methyl-
Found 5 products.