CymitQuimica logo

CAS 103879-29-4

:

3-CHLORO-4,5-DIFLUOROBENZONITRILE

Description:
3-Chloro-4,5-difluorobenzenonitrile is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a chlorine atom and two fluorine atoms, along with a nitrile functional group (-C≡N). The presence of the chlorine and fluorine substituents contributes to its unique chemical properties, such as increased reactivity and potential for forming hydrogen bonds. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests that it could be used in various applications, including as an intermediate in the synthesis of pharmaceuticals or agrochemicals. The nitrile group imparts certain polar characteristics, which can influence its interactions in chemical reactions. Additionally, the compound's specific arrangement of halogen atoms can affect its electronic properties and stability. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks. Overall, 3-chloro-4,5-difluorobenzenonitrile is a notable compound in the field of organic chemistry.
Formula:C7H2ClF2N
InChI:InChI=1S/C7H2ClF2N/c8-5-1-4(3-11)2-6(9)7(5)10/h1-2H
InChI key:YJCJTNTXRXNHER-UHFFFAOYSA-N
SMILES:C1=C(C=C(C(=C1F)F)Cl)C#N
Found 4 products.