CymitQuimica logo

CAS 103879-31-8

:

3,5-Dichloro-4-fluorobenzonitrile

Description:
3,5-Dichloro-4-fluorobenzonitrile is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two chlorine atoms and one fluorine atom, along with a nitrile functional group (-C≡N). This compound typically appears as a solid at room temperature and is known for its relatively high stability due to the presence of the aromatic ring. The chlorine and fluorine substituents contribute to its unique reactivity and potential applications in various chemical reactions, including nucleophilic substitutions. The nitrile group enhances its polarity, making it soluble in polar organic solvents. Additionally, 3,5-Dichloro-4-fluorobenzonitrile may exhibit biological activity, which can be of interest in pharmaceutical research. Safety data indicates that, like many halogenated compounds, it should be handled with care due to potential toxicity and environmental impact. Overall, this compound is significant in synthetic organic chemistry and may serve as an intermediate in the synthesis of more complex molecules.
Formula:C7H2Cl2FN
InChI:InChI=1S/C7H2Cl2FN/c8-5-1-4(3-11)2-6(9)7(5)10/h1-2H
InChI key:InChIKey=RIOPZMHLYZUNFX-UHFFFAOYSA-N
SMILES:C(#N)C1=CC(Cl)=C(F)C(Cl)=C1
Synonyms:
  • 4-Fluoro-3,5-dichlorobenzonitrile
  • Benzonitrile, 3,5-dichloro-4-fluoro-
  • 3,5-Dichloro-4-fluorobenzonitrile
Found 4 products.