CymitQuimica logo

CAS 10388-10-0

:

2-chloro-1,4-bis(trichloromethyl)benzene

Description:
2-Chloro-1,4-bis(trichloromethyl)benzene, with the CAS number 10388-10-0, is an aromatic compound characterized by the presence of a benzene ring substituted with a chlorine atom and two trichloromethyl groups. This compound is typically a colorless to pale yellow solid at room temperature and is known for its high density and low solubility in water, making it more soluble in organic solvents. It exhibits significant chemical stability due to the strength of the carbon-chlorine bonds, but it can undergo reactions typical of aromatic compounds, such as electrophilic substitution. The presence of multiple chlorine atoms contributes to its potential as a persistent environmental pollutant, raising concerns regarding its toxicity and bioaccumulation. Additionally, it may have applications in organic synthesis and as an intermediate in the production of other chemical compounds. Safety precautions are necessary when handling this substance, as it may pose health risks through inhalation or skin contact.
Formula:C8H3Cl7
InChI:InChI=1/C8H3Cl7/c9-6-3-4(7(10,11)12)1-2-5(6)8(13,14)15/h1-3H
InChI key:URRUNMMSCQPLOQ-UHFFFAOYSA-N
SMILES:c1cc(c(cc1C(Cl)(Cl)Cl)Cl)C(Cl)(Cl)Cl
Synonyms:
  • Alpha,alpha,alpha,alpha',alpha',alpha'-2-heptachloro-p-xylene
Found 4 products.