CymitQuimica logo

CAS 103882-09-3

:

Boc-p-iodo-DL-Phe-OH

Description:
Boc-p-iodo-DL-Phe-OH, also known as Boc-protected p-iodo-DL-phenylalanine, is an amino acid derivative characterized by the presence of a tert-butyloxycarbonyl (Boc) protecting group on the amino group and an iodine atom substituted at the para position of the phenyl ring. This compound is typically used in peptide synthesis and medicinal chemistry due to its ability to introduce iodine into peptide sequences, which can enhance biological activity or facilitate radiolabeling for imaging studies. The Boc group provides stability during synthesis and can be easily removed under acidic conditions to yield the free amino acid. The presence of the iodine atom can also influence the compound's reactivity and interaction with biological targets. As a DL-amino acid, it exists as a racemic mixture of both enantiomers, which may exhibit different biological properties. Overall, Boc-p-iodo-DL-Phe-OH serves as a valuable intermediate in the development of novel therapeutic agents and research applications in biochemistry.
Formula:C14H18INO4
InChI:InChI=1S/C14H18INO4/c1-14(2,3)20-13(19)16-11(12(17)18)8-9-4-6-10(15)7-5-9/h4-7,11H,8H2,1-3H3,(H,16,19)(H,17,18)
InChI key:JZLZDBGQWRBTHN-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)NC(CC1=CC=C(C=C1)I)C(=O)O
Found 1 products.