CymitQuimica logo

CAS 103883-23-4

:

4-[[(Methylsulfonyl)oxy]methyl]-2-azetidinone

Description:
4-[[(Methylsulfonyl)oxy]methyl]-2-azetidinone, with the CAS number 103883-23-4, is a chemical compound characterized by its unique structural features, including a four-membered azetidinone ring and a methylsulfonyl group. This compound typically exhibits properties associated with both cyclic amides and sulfonyl compounds, which may influence its reactivity and solubility. The presence of the methylsulfonyl moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to enhance solubility and bioavailability. The azetidinone structure may also contribute to its biological activity, as cyclic amides are often found in various natural products and synthetic drugs. Additionally, the compound's stability and reactivity can be influenced by the functional groups attached to the azetidinone ring, making it a subject of interest for further research in organic synthesis and drug design. Overall, this compound represents a versatile scaffold for exploring new chemical entities with potential therapeutic applications.
Formula:C5H9NO4S
InChI:InChI=1S/C5H9NO4S/c1-11(8,9)10-3-4-2-5(7)6-4/h4H,2-3H2,1H3,(H,6,7)
InChI key:InChIKey=GJMNDGSMSZLFFN-UHFFFAOYSA-N
SMILES:C(OS(C)(=O)=O)C1CC(=O)N1
Synonyms:
  • 2-Azetidinone, 4-[[(methylsulfonyl)oxy]methyl]-
  • 2-Azetidinone, 4-[[(methylsulfonyl)oxy]methyl]-, (±)-
  • 4-[[(Methylsulfonyl)oxy]methyl]-2-azetidinone
Found 1 products.