CymitQuimica logo

CAS 103886-92-6

:

(E)-2-((phenylimino)methyl)phenol

Description:
(E)-2-((Phenylimino)methyl)phenol, also known by its CAS number 103886-92-6, is an organic compound characterized by the presence of both phenolic and imine functional groups. This compound features a phenol moiety with a phenylimino group attached to the carbon adjacent to the hydroxyl group, resulting in a structure that can exhibit both acidic and basic properties. The imine functionality contributes to its potential reactivity, allowing it to participate in various chemical reactions, such as condensation and coordination with metal ions. The compound is typically a solid at room temperature and may exhibit solubility in organic solvents, depending on the specific conditions. Its structural features suggest potential applications in fields such as organic synthesis, materials science, and coordination chemistry. Additionally, the presence of the phenyl groups may impart interesting electronic properties, making it a candidate for studies in molecular electronics or as a ligand in coordination complexes. Overall, (E)-2-((phenylimino)methyl)phenol is a versatile compound with diverse chemical behavior.
Formula:C13H11NO
InChI:InChI=1S/C13H11NO/c15-13-9-5-4-6-11(13)10-14-12-7-2-1-3-8-12/h1-10,15H
InChI key:QIYHCQVVYSSDTI-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)N=CC2=CC=CC=C2O
Synonyms:
  • (E)-2-((phenylimino)methyl)phenol
  • Phenol, 2-[(E)-(phenylimino)methyl]-
Found 3 products.