CymitQuimica logo

CAS 103889-86-7

:

(S)-AMINO-(2-METHOXY-PHENYL)-ACETIC ACID

Description:
(S)-Amino-(2-methoxy-phenyl)-acetic acid, commonly referred to as (S)-AMPA, is an amino acid derivative characterized by its chiral center, which imparts specific stereochemical properties. This compound features a methoxy group attached to a phenyl ring, contributing to its hydrophobic characteristics, while the amino and carboxylic acid functional groups provide polar characteristics. The presence of the methoxy group enhances its solubility in organic solvents and influences its biological activity. (S)-AMPA is known for its role as a neurotransmitter and is involved in excitatory signaling in the central nervous system, particularly as an agonist for certain glutamate receptors. Its structural properties allow it to participate in various biochemical pathways, making it of interest in pharmacological research. Additionally, the compound's chirality is significant, as different enantiomers can exhibit distinct biological activities. Overall, (S)-AMPA is a compound of interest in both synthetic chemistry and neuropharmacology due to its unique structural and functional characteristics.
Formula:C9H11NO3
InChI:InChI=1/C9H11NO3/c1-13-7-5-3-2-4-6(7)8(10)9(11)12/h2-5,8H,10H2,1H3,(H,11,12)/t8-/m0/s1
InChI key:DQSACLYOIBPCJU-QMMMGPOBSA-N
SMILES:COc1ccccc1[C@@H](C(=O)O)N
Synonyms:
  • (S)-2-Methoxy-Phenylglycine
  • (2S)-amino(2-methoxyphenyl)ethanoic acid
  • S-2-Methoxyphenylglycine
Found 4 products.