
CAS 1038972-16-5
:N-methyl-N-(4-nitrophenyl)-2-(piperazin-1-yl)acetamide
Description:
N-methyl-N-(4-nitrophenyl)-2-(piperazin-1-yl)acetamide is a chemical compound characterized by its unique molecular structure, which includes a piperazine ring, a nitrophenyl group, and an acetamide moiety. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of amide and piperazine functionalities. The nitro group contributes to its electronic properties, potentially influencing its reactivity and interactions with biological targets. The piperazine ring is known for its role in pharmacological activity, often enhancing the compound's ability to interact with various receptors. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could confer specific biological activities. Safety and handling precautions should be observed, as with many organic compounds, to mitigate any potential hazards associated with its use.
Formula:C13H18N4O3
InChI:InChI=1S/C13H18N4O3/c1-15(11-2-4-12(5-3-11)17(19)20)13(18)10-16-8-6-14-7-9-16/h2-5,14H,6-10H2,1H3
InChI key:LRLUTTLRQCVDKQ-UHFFFAOYSA-N
SMILES:CN(C1=CC=C(C=C1)[N+](=O)[O-])C(=O)CN2CCNCC2
Synonyms:- Nintedanib Impurity 30
- Nintedanib impurity 6/N-Methyl-N-(4-nitrophenyl)-2-(piperazin-1-yl)acetamide
- N-methyl-N-(4-nitrophenyl)-2-(piperazin-1-yl)acetamide
- Nintedanib-007
- 1-Piperazineacetamide, N-methyl-N-(4-nitrophenyl)-
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery

