CymitQuimica logo

CAS 103900-77-2

:

3-Pyridinecarboxylic acid,1,6-dihydro-4-hydroxy-6-oxo-2-(trifluoromethyl)-, ethyl ester

Description:
3-Pyridinecarboxylic acid, 1,6-dihydro-4-hydroxy-6-oxo-2-(trifluoromethyl)-, ethyl ester, identified by CAS number 103900-77-2, is a chemical compound that features a pyridine ring substituted with various functional groups. This compound typically exhibits characteristics associated with both pyridine derivatives and carboxylic acid esters. The presence of the trifluoromethyl group suggests enhanced lipophilicity and potential biological activity, as fluorinated compounds often exhibit unique pharmacological properties. The ethyl ester moiety indicates that the compound may have applications in organic synthesis or as an intermediate in pharmaceutical development. Additionally, the hydroxyl and keto groups contribute to its reactivity, potentially allowing for further derivatization. The compound's structure may also influence its solubility, stability, and interaction with biological systems. Overall, this compound represents a complex structure with potential utility in various chemical and medicinal applications, warranting further investigation into its properties and uses.
Formula:C9H8F3NO4
InChI:InChI=1S/C9H8F3NO4/c1-2-17-8(16)6-4(14)3-5(15)13-7(6)9(10,11)12/h3H,2H2,1H3,(H2,13,14,15)
InChI key:QZEXFLHXHOIAAK-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=C(NC(=O)C=C1O)C(F)(F)F
Found 2 products.