CymitQuimica logo

CAS 103913-29-7

:

Acetamide, N-[4-(4-morpholinyl)phenyl]-

Description:
Acetamide, N-[4-(4-morpholinyl)phenyl]- is an organic compound characterized by its amide functional group, which is derived from acetic acid. This compound features a morpholine ring, a six-membered heterocyclic structure containing both oxygen and nitrogen, attached to a phenyl group. The presence of the morpholine moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The compound is likely to exhibit moderate solubility in polar solvents, given the presence of the amide and morpholine functionalities. Its molecular structure may impart specific biological activities, making it of interest in research related to drug design and synthesis. Additionally, the compound's stability and reactivity can be influenced by the electronic properties of the substituents on the phenyl ring. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Overall, N-[4-(4-morpholinyl)phenyl]acetamide represents a class of compounds that may offer valuable insights into chemical and biological interactions.
Formula:C12H16N2O2
InChI:InChI=1S/C12H16N2O2/c1-10(15)13-11-2-4-12(5-3-11)14-6-8-16-9-7-14/h2-5H,6-9H2,1H3,(H,13,15)
InChI key:FWCIAVMWCOEWGF-UHFFFAOYSA-N
SMILES:CC(=O)NC1=CC=C(C=C1)N2CCOCC2
Found 1 products.