CAS 103935-47-3
:2-Bromoethyl triflate
Description:
2-Bromoethyl triflate, with the CAS number 103935-47-3, is an organic compound characterized by its structure, which includes a bromine atom and a triflate group (-OSO2CF3) attached to an ethyl chain. This compound is typically a colorless to pale yellow liquid and is known for its reactivity, particularly in nucleophilic substitution reactions due to the presence of the triflate leaving group, which is considered one of the best leaving groups in organic chemistry. The bromine atom also contributes to its electrophilic nature, making it useful in various synthetic applications, including the formation of carbon-carbon bonds and the introduction of functional groups. 2-Bromoethyl triflate is often employed in the synthesis of more complex molecules in pharmaceutical and materials chemistry. However, it should be handled with care due to its potential toxicity and reactivity, necessitating appropriate safety precautions during use.
Formula:C3H4BrF3O3S
InChI:InChI=1S/C3H4BrF3O3S/c4-1-2-10-11(8,9)3(5,6)7/h1-2H2
InChI key:KENPFZUYYWVXNW-UHFFFAOYSA-N
SMILES:C(CBr)OS(=O)(=O)C(F)(F)F
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2-Bromoethyl trifluoromethanesulphonate
CAS:2-Bromoethyl trifluoromethanesulphonateFormula:C3H4BrF3O3SPurity:>97%Color and Shape:Colourless to yellow LiquidMolecular weight:257.026262-Bromoethyl trifluoromethanesulfonate
CAS:Formula:C3H4BrF3O3SPurity:95%Color and Shape:LiquidMolecular weight:257.02632-Bromoethyl trifluoromethanesulfonate
CAS:2-Bromoethyl trifluoromethanesulfonateFormula:C3H4BrF3O3SPurity:95%Molecular weight:257.032-Bromoethyl trifluoromethanesulfonate
CAS:2-Bromoethyl trifluoromethanesulfonate is a synthetic, diagnostic, and therapeutic agent that is used as a radiotracer for imaging the uptake of tyrosinase in cancer cells. It binds to the benzodiazepine receptor and has a high affinity for this site. This compound also inhibits glutamate release from nerve endings and thus can be used to treat epilepsy. 2-Bromoethyl trifluoromethanesulfonate can inhibit protein synthesis by binding to the enzyme ribosomal protein S6 kinase (S6K) at an allosteric site. The binding of 2-bromoethyl trifluoromethanesulfonate causes a conformational change in the S6K molecule that results in inhibition of its catalytic activity.Formula:C3H4BrF3O3SPurity:Min. 95%Molecular weight:257.03 g/mol2-Bromoethyl trifluoromethanesulfonate
CAS:Formula:C3H4BrF3O3SPurity:98%Color and Shape:LiquidMolecular weight:257.02




