CymitQuimica logo

CAS 103942-92-3

:

7-Chloro-1-phenazinecarboxylic acid

Description:
7-Chloro-1-phenazinecarboxylic acid is a chemical compound characterized by its phenazine core, which is a bicyclic structure composed of two fused benzene rings and a nitrogen-containing heterocycle. The presence of a carboxylic acid functional group (-COOH) at the 1-position and a chlorine atom at the 7-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. It can participate in various chemical reactions, including nucleophilic substitutions and acid-base reactions, owing to its functional groups. The chlorine substituent can influence the compound's reactivity and biological activity, making it of interest in medicinal chemistry and material science. Additionally, the phenazine structure is known for its potential applications in dyes, pigments, and as a scaffold in drug development. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C13H7ClN2O2
InChI:InChI=1S/C13H7ClN2O2/c14-7-4-5-9-11(6-7)15-10-3-1-2-8(13(17)18)12(10)16-9/h1-6H,(H,17,18)
InChI key:InChIKey=BKNYZPGHEKKBDS-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C2=C(N=C3C(=N2)C=CC(Cl)=C3)C=CC1
Synonyms:
  • 1-Phenazinecarboxylic Acid, 7-Chloro-
  • 7-Chloro-1-phenazinecarboxylic acid
  • 7-Chlorophenazine-1-carboxylic acid
Found 1 products.