
CAS 1039455-84-9
:COTI-2
Description:
COTI-2, with the CAS number 1039455-84-9, is a small molecule that has garnered attention in the field of medicinal chemistry, particularly for its potential as an anticancer agent. It is known to act as a selective inhibitor of the protein p53, which plays a crucial role in regulating the cell cycle and preventing tumor formation. The compound exhibits a unique mechanism of action by stabilizing mutant forms of p53, thereby restoring its function in cancer cells that harbor p53 mutations. COTI-2 has been studied for its efficacy against various cancer types, including ovarian and colorectal cancers. Its chemical structure features specific functional groups that contribute to its biological activity and solubility profile. Additionally, COTI-2 has undergone preclinical and clinical evaluations to assess its safety, pharmacokinetics, and therapeutic potential. As research continues, COTI-2 represents a promising candidate in the development of targeted cancer therapies, highlighting the importance of small molecules in modern oncology.
Formula:C19H22N6S
InChI:InChI=1S/C19H22N6S/c26-19(23-22-16-7-3-5-15-6-4-10-21-18(15)16)25-13-11-24(12-14-25)17-8-1-2-9-20-17/h1-2,4,6,8-10H,3,5,7,11-14H2,(H,23,26)/b22-16+
InChI key:UTDAKQMBNSHJJB-CJLVFECKSA-N
SMILES:C1CC2=C(/C(=N/NC(=S)N3CCN(CC3)C4=CC=CC=N4)/C1)N=CC=C2
Synonyms:- COTI-2;COTI 2;COTI2
- COTI-2
- 1-Piperazinecarbothioic acid, 4-(2-pyridinyl)-, 2-(6,7-dihydro-8(5H)-quinolinylidene)hydrazide
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
N'-(6,7-Dihydroquinolin-8(5H)-Ylidene)-4-(Pyridin-2-Yl)Piperazine-1-Carbothiohydrazide
CAS:N'-(6,7-Dihydroquinolin-8(5H)-Ylidene)-4-(Pyridin-2-Yl)Piperazine-1-CarbothiohydrazideFormula:C19H22N6SPurity:≥98%Molecular weight:366.48COTI-2
CAS:N'-(6,7-Dihydroquinolin-8(5H)-ylidene)-4-(pyridin-2-yl)piperazine-1-carbothiohydrazideFormula:C19H22N6SPurity:98%Molecular weight:366.48COTI-2
CAS:COTI-2, an orally available thiosemicarbazone, is an activator of mutant forms of the p53 protein with potential antineoplastic activity.Formula:C19H22N6SPurity:99% - 99.55%Color and Shape:SolidMolecular weight:366.48COTI-2
CAS:COTI-2 is a copper complex that has been shown to selectively bind to the tumor suppressor protein, annexin A2. It inhibits tumor growth and induces apoptosis in cancer cells in vitro and in vivo. The mechanism of action of COTI-2 is not known but it may inhibit the activity of efflux pumps, leading to increased accumulation of anticancer drugs in tumor cells. In addition, COTI-2 may be a predictive biomarker for radiation exposure and an indicator for the development of cancer. Clinical studies have shown that COTI-2 is a potential biomarker for identifying patients who are at risk for developing lung cancer.Formula:C19H22N6SPurity:Min. 95%Molecular weight:366.48 g/mol




