CymitQuimica logo

CAS 103951-51-5

:

N-ADAMANTAN-2-YL-2-CHLORO-ACETAMIDE

Description:
N-Adamantan-2-yl-2-chloroacetamide is a chemical compound characterized by its adamantane structure, which is a polycyclic hydrocarbon known for its stability and unique three-dimensional shape. The presence of a chloroacetamide functional group indicates that this compound contains both a chlorine atom and an amide group, which can influence its reactivity and solubility. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry. The adamantane moiety often contributes to favorable pharmacokinetic properties, such as increased membrane permeability. Additionally, the chlorinated acetamide structure may enhance interactions with biological targets, potentially leading to applications in drug development. The compound's molecular weight, melting point, and solubility characteristics would be essential for understanding its behavior in various environments, including biological systems. Overall, N-adamantan-2-yl-2-chloroacetamide represents a unique combination of structural features that may confer specific chemical and biological properties.
Formula:C12H18ClNO
InChI:InChI=1/C12H18ClNO/c13-6-11(15)14-12-9-2-7-1-8(4-9)5-10(12)3-7/h7-10,12H,1-6H2,(H,14,15)
SMILES:C1C2CC3CC1CC(C2)C3N=C(CCl)O
Synonyms:
  • acetamide, 2-chloro-N-tricyclo[3.3.1.1~3,7~]dec-2-yl-
  • N-(Adamantan-2-yl)-2-chloroacetamide
  • 2-chloro-N-(tricyclo[3.3.1.1~3,7~]dec-2-yl)acetamide
  • N-Adamantan-2-yl-2-chloro-acetamide
Found 1 products.