CAS 103957-16-0

D-Ornithine, 2-(difluoromethyl)-

Description:

D-Ornithine, 2-(difluoromethyl)-, with the CAS number 103957-16-0, is a chemical compound that features a difluoromethyl group attached to the ornithine backbone. Ornithine is a non-proteinogenic amino acid that plays a crucial role in the urea cycle, facilitating the removal of ammonia from the body. The introduction of the difluoromethyl group can significantly alter the compound's biological activity and properties, potentially enhancing its pharmacological profile. This modification may influence its interaction with enzymes or receptors, making it of interest in medicinal chemistry and drug development. The compound is typically characterized by its molecular structure, which includes both amine and carboxylic acid functional groups, contributing to its solubility and reactivity. Additionally, the presence of fluorine atoms often imparts unique characteristics such as increased lipophilicity and metabolic stability. As with many fluorinated compounds, D-Ornithine, 2-(difluoromethyl)- may exhibit distinct biological activities, warranting further investigation for potential therapeutic applications.

Formula: C₆H₁₂F₂N₂O₂

InChI: InChI=1S/C6H12F2N2O2/c7-4(8)6(10,5(11)12)2-1-3-9/h4H,1-3,9-10H2,(H,11,12)/t6-/m0/s1

InChI key: VLCYCQAOQCDTCN-LURJTMIESA-N

SMILES: C(C[C@](C(F)F)(C(=O)O)N)CN

(R)-Eflornithine DiHCl

CAS: 103957-16-0

Formula: C₆H₁₂F₂N₂O₂·2HCl

Color and Shape: White To Off-White Solid

Molecular weight: 182.17 2 36.46

Ref: 4Z-E-255

(R)-Eflornithine Dihydrochloride

Controlled Product

CAS: 103957-16-0

Applications (R)-Eflornithine Dihydrochloride, is an irreversible inhibitor of ornithine decarboxylase.
References Haegele, K., et al.: Clin. Pharmacol. Ther., 30, 210 (1981); Wolf, J., et al.: Int. J. Dermatol., 46, 94 (2007);

Formula: C₆H₁₂F₂N₂O₂·2HCl

Color and Shape: Neat

Molecular weight: 182.17

Ref: TR-E436015

(R)-Eflornithine

CAS: 103957-16-0

Formula: C₆H₁₂F₂N₂O₂

Molecular weight: 182.17

Ref: ST-EA-CP-O38017