CAS 103957-16-0
:D-Ornithine, 2-(difluoromethyl)-
Description:
D-Ornithine, 2-(difluoromethyl)-, with the CAS number 103957-16-0, is a chemical compound that features a difluoromethyl group attached to the ornithine backbone. Ornithine is a non-proteinogenic amino acid that plays a crucial role in the urea cycle, facilitating the removal of ammonia from the body. The introduction of the difluoromethyl group can significantly alter the compound's biological activity and properties, potentially enhancing its pharmacological profile. This modification may influence its interaction with enzymes or receptors, making it of interest in medicinal chemistry and drug development. The compound is typically characterized by its molecular structure, which includes both amine and carboxylic acid functional groups, contributing to its solubility and reactivity. Additionally, the presence of fluorine atoms often imparts unique characteristics such as increased lipophilicity and metabolic stability. As with many fluorinated compounds, D-Ornithine, 2-(difluoromethyl)- may exhibit distinct biological activities, warranting further investigation for potential therapeutic applications.
Formula:C6H12F2N2O2
InChI:InChI=1S/C6H12F2N2O2/c7-4(8)6(10,5(11)12)2-1-3-9/h4H,1-3,9-10H2,(H,11,12)/t6-/m0/s1
InChI key:VLCYCQAOQCDTCN-LURJTMIESA-N
SMILES:C(C[C@](C(F)F)(C(=O)O)N)CN
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
(R)-Eflornithine DiHCl
CAS:Formula:C6H12F2N2O2·2HClColor and Shape:White To Off-White SolidMolecular weight:182.17 2 36.46(R)-Eflornithine Dihydrochloride
CAS:Controlled ProductApplications (R)-Eflornithine Dihydrochloride, is an irreversible inhibitor of ornithine decarboxylase.
References Haegele, K., et al.: Clin. Pharmacol. Ther., 30, 210 (1981); Wolf, J., et al.: Int. J. Dermatol., 46, 94 (2007);Formula:C6H12F2N2O2·2HClColor and Shape:NeatMolecular weight:182.17


