CymitQuimica logo

CAS 10396-05-1

:

4-Isothiocyanatophenyl ether

Description:
4-Isothiocyanatophenyl ether, with the CAS number 10396-05-1, is an organic compound characterized by the presence of both an isothiocyanate functional group and an ether linkage. This compound typically exhibits a phenolic structure, where the isothiocyanate group (-N=C=S) is attached to the para position of a phenyl ring that is further connected to an ether group (-O-). The presence of the isothiocyanate group imparts notable reactivity, particularly in nucleophilic addition reactions, making it useful in various chemical syntheses and applications, including in the development of agrochemicals and pharmaceuticals. Additionally, the ether functionality contributes to its solubility properties, influencing its behavior in different solvents. The compound may also exhibit biological activity, which can be explored in the context of medicinal chemistry. Overall, 4-Isothiocyanatophenyl ether is a versatile compound with significant implications in both synthetic and applied chemistry.
Formula:C14H8N2OS2
InChI:InChI=1/C14H8N2OS2/c18-9-15-11-1-5-13(6-2-11)17-14-7-3-12(4-8-14)16-10-19/h1-8H
InChI key:VFRHGFVMLLSTNS-UHFFFAOYSA-N
SMILES:c1cc(ccc1N=C=S)Oc1ccc(cc1)N=C=S
Synonyms:
  • 1,1'-Oxybis(4-Isothiocyanatobenzene)
Found 4 products.