CymitQuimica logo

CAS 103965-99-7

:

4-(2-Bromo-phenyl)-thiazol-2-ylamine

Description:
4-(2-Bromo-phenyl)-thiazol-2-ylamine, with the CAS number 103965-99-7, is an organic compound characterized by its thiazole and amine functional groups. This compound features a thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms, contributing to its unique chemical properties. The presence of a bromo substituent on the phenyl ring enhances its reactivity and potential for further chemical modifications. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility, stability, and reactivity can vary depending on the solvent and environmental conditions. Additionally, the compound's molecular structure suggests potential interactions with biological targets, which could be explored in pharmacological studies. Safety and handling precautions should be observed, as with any chemical substance, due to the presence of bromine, which can be hazardous. Overall, 4-(2-Bromo-phenyl)-thiazol-2-ylamine represents a versatile building block in organic synthesis and pharmaceutical research.
Formula:C9H7BrN2S
InChI:InChI=1S/C9H7BrN2S/c10-7-4-2-1-3-6(7)8-5-13-9(11)12-8/h1-5H,(H2,11,12)
InChI key:HBAOQMFTWSDKDV-UHFFFAOYSA-N
SMILES:C1=CC=C(C(=C1)C2=CSC(=N2)N)Br
Found 4 products.