CymitQuimica logo

CAS 103966-65-0

:

Benzenemethanol, alpha-methyl-3-nitro-, (alphaS)- (9CI)

Description:
Benzenemethanol, alpha-methyl-3-nitro-, (alphaS)-, also known by its CAS number 103966-65-0, is an organic compound characterized by its aromatic structure and functional groups. It features a benzene ring attached to a methanol group, with a nitro group and a methyl group positioned on the benzene ring. The presence of the nitro group introduces significant polarity and reactivity, making it a potential candidate for various chemical reactions, including electrophilic substitution. The (alphaS)- designation indicates a specific stereochemistry, which can influence the compound's biological activity and interaction with other molecules. This compound may exhibit properties typical of nitro-substituted aromatic compounds, such as increased solubility in polar solvents and potential toxicity. Its applications could range from use in organic synthesis to potential roles in pharmaceuticals or agrochemicals, depending on its reactivity and biological properties. As with many nitro compounds, safety precautions are essential due to potential hazards associated with handling and exposure.
Formula:C8H9NO3
InChI:InChI=1S/C8H9NO3/c1-6(10)7-3-2-4-8(5-7)9(11)12/h2-6,10H,1H3/t6-/m0/s1
InChI key:FRPQAVXDUWMFCK-LURJTMIESA-N
SMILES:C[C@@H](C1=CC(=CC=C1)[N+](=O)[O-])O
Found 5 products.