CymitQuimica logo

CAS 103966-66-1

:

Benzene, 4-bromo-2-methoxy-1-nitro-

Description:
Benzene, 4-bromo-2-methoxy-1-nitro- is an organic compound characterized by a benzene ring substituted with three functional groups: a bromine atom, a methoxy group (-OCH3), and a nitro group (-NO2). The presence of these substituents influences its chemical properties and reactivity. The bromine atom, being a halogen, can participate in electrophilic aromatic substitution reactions, while the nitro group is a strong electron-withdrawing group, which can affect the electron density of the aromatic ring, making it more reactive towards electrophiles. The methoxy group, on the other hand, is an electron-donating group that can stabilize the aromatic system. This compound is likely to be a yellow to brown solid at room temperature and may exhibit moderate solubility in organic solvents. Its applications could range from use in organic synthesis to potential roles in pharmaceuticals or agrochemicals, depending on its reactivity and the specific transformations it can undergo. Safety precautions should be taken when handling this compound due to the presence of the nitro group, which can pose health risks.
Formula:C7H6BrNO3
InChI:InChI=1S/C7H6BrNO3/c1-12-7-4-5(8)2-3-6(7)9(10)11/h2-4H,1H3
InChI key:DJKPQYBFSAJUBS-UHFFFAOYSA-N
SMILES:COC1=C(C=CC(=C1)Br)[N+](=O)[O-]
Synonyms:
  • 4-Bromo-2-Methoxy-1-Nitrobenzene
  • 5-Bromo-2-nitroanisole
Found 6 products.