CymitQuimica logo

CAS 10397-15-6

:

4,6-dichloro-N-methylpyrimidin-2-amine

Description:
4,6-Dichloro-N-methylpyrimidin-2-amine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing nitrogen atoms. This compound features two chlorine substituents at the 4 and 6 positions of the pyrimidine ring, contributing to its reactivity and potential biological activity. The presence of the N-methyl group at the 2-position enhances its solubility and may influence its interaction with biological targets. It is typically a solid at room temperature and may exhibit properties such as moderate to high stability under standard conditions. The compound is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential applications as a building block in the synthesis of more complex molecules. Additionally, its chlorine substituents may impart specific characteristics such as increased lipophilicity or altered electronic properties, which can affect its behavior in chemical reactions and biological systems. Safety data should be consulted for handling and usage, as halogenated compounds can pose environmental and health risks.
Formula:C5H5Cl2N3
InChI:InChI=1/C5H5Cl2N3/c1-8-5-9-3(6)2-4(7)10-5/h2H,1H3,(H,8,9,10)
InChI key:UBGCYDBGKBKRCT-UHFFFAOYSA-N
SMILES:CN=c1[nH]c(cc(Cl)n1)Cl
Found 5 products.