CAS 103974-74-9
:Esculentic acid
Description:
Esculentic acid, with the CAS number 103974-74-9, is a chemical compound that belongs to the class of organic acids. It is characterized by its carboxylic acid functional group, which imparts acidic properties and reactivity typical of such compounds. Esculentic acid is known for its potential biological activity, including antimicrobial and antioxidant properties, making it of interest in various fields such as pharmaceuticals and food science. The compound is typically soluble in polar solvents, which is common for many organic acids, and its structure may include additional functional groups that contribute to its reactivity and interactions with other molecules. While specific applications and detailed studies may vary, the exploration of esculentic acid's properties continues to be relevant in research focused on natural products and their derivatives. As with any chemical substance, safety and handling precautions should be observed, particularly in laboratory settings.
Formula:C30H48O5
InChI:InChI=1S/C30H48O5/c1-17-9-12-30(25(34)35)14-13-28(5)19(23(30)18(17)2)7-8-22-26(3)15-20(32)24(33)27(4,16-31)21(26)10-11-29(22,28)6/h7,17-18,20-24,31-33H,8-16H2,1-6H3,(H,34,35)/t17-,18+,20-,21-,22-,23+,24-,26+,27+,28-,29-,30+/m1/s1
InChI key:InChIKey=JXSVIVRDWWRQRT-SVOQGVCWSA-N
SMILES:C[C@]12[C@@]3(C)C([C@]4([C@@](C(O)=O)(CC3)CC[C@@H](C)[C@@H]4C)[H])=CC[C@@]1([C@]5(C)[C@@](CC2)([C@@](CO)(C)[C@H](O)[C@H](O)C5)[H])[H]
Synonyms:- (2α,3α,4α)-2,3,23-Trihydroxyurs-12-en-28-oic acid
- 2a,3a,23-Trihydroxyurs-12-en-28-oic acid
- Esculentic acid
- Esculentic acid (Diplazium)
- Urs-12-en-28-oic acid, 2,3,23-trihydroxy-, (2α,3α,4α)-
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Esculentic acid
CAS:Esculentic acid has anti-inflammatory effect, it has protective effects against LPS-induced endotoxic shock may be mediated, at least in part, by regulation theFormula:C30H48O5Purity:98%Color and Shape:SolidMolecular weight:488.7Esculentic acid
CAS:Controlled ProductEsculentic acid is a triterpenoid compound, which is a subclass of terpenoids primarily found in various plant sources, including certain vegetables and medicinal herbs. This compound is synthesized through the mevalonate pathway in plants and is often isolated for research due to its potential pharmacological properties.Formula:C30H48O5Purity:Min. 95%Molecular weight:488.7 g/mol



