CymitQuimica logo

CAS 1039758-67-2

:

1-Cyclopropyl-1H-pyrrole-2-carboxaldehyde

Description:
1-Cyclopropyl-1H-pyrrole-2-carboxaldehyde is an organic compound characterized by its unique structural features, which include a pyrrole ring and a cyclopropyl group. The presence of the aldehyde functional group contributes to its reactivity, making it a potential candidate for various chemical reactions, such as nucleophilic additions. This compound typically exhibits a colorless to pale yellow appearance and may have a distinct odor. Its molecular structure allows for interesting interactions in biological systems, which could be explored for potential pharmaceutical applications. The compound's solubility is generally influenced by the polarity of its functional groups, and it may be soluble in organic solvents while having limited solubility in water. Additionally, the cyclopropyl moiety can impart unique strain and reactivity patterns, making it a subject of interest in synthetic organic chemistry. Safety data should be consulted for handling, as with any chemical, to ensure proper precautions are taken due to potential hazards associated with its use.
Formula:C8H9NO
InChI:InChI=1S/C8H9NO/c10-6-8-2-1-5-9(8)7-3-4-7/h1-2,5-7H,3-4H2
InChI key:InChIKey=PPAXARQIEKNOJI-UHFFFAOYSA-N
SMILES:C(=O)C=1N(C=CC1)C2CC2
Synonyms:
  • 1-Cyclopropyl-1H-pyrrole-2-carbaldehyde
  • 1H-Pyrrole-2-carboxaldehyde, 1-cyclopropyl-
  • 1-Cyclopropyl-1H-pyrrole-2-carboxaldehyde
  • 1-Cyclopropylpyrrole-2-carbaldehyde
Found 2 products.