CAS 103977-79-3
:3-Bromo-2,4-difluorobenzenamine
Description:
3-Bromo-2,4-difluorobenzenamine, with the CAS number 103977-79-3, is an organic compound that belongs to the class of aromatic amines. It features a benzene ring substituted with two fluorine atoms and one bromine atom, along with an amino group (-NH2). The presence of these halogen substituents significantly influences its chemical properties, including reactivity and polarity. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the amino group. Its structure suggests potential applications in pharmaceuticals, agrochemicals, and materials science, particularly in the synthesis of more complex molecules. The bromine and fluorine atoms can participate in various chemical reactions, making it a versatile intermediate in organic synthesis. Additionally, the compound's electronic properties may affect its behavior in biological systems, warranting further investigation into its toxicity and environmental impact. As with many halogenated compounds, proper handling and safety precautions are essential due to potential health hazards.
Formula:C6H4BrF2N
InChI:InChI=1S/C6H4BrF2N/c7-5-3(8)1-2-4(10)6(5)9/h1-2H,10H2
InChI key:InChIKey=NUDDKKLQNVWKRU-UHFFFAOYSA-N
SMILES:BrC1=C(F)C(N)=CC=C1F
Synonyms:- 3-Bromo-2,4-difluorobenzenamine
- 3-Amino-2,6-difluorobromobenzene
- 3-Bromo-2,4-difluoroaniline
- Benzenamine, 3-bromo-2,4-difluoro-
- 3-Bromo-2,4-difluorophenylamine
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
3-Bromo-2,4-difluoroaniline
CAS:3-Bromo-2,4-difluoroanilineFormula:C6H4BrF2NPurity:≥95%Color and Shape:SolidMolecular weight:208.003463-bromo-2,4-difluoroaniline
CAS:Formula:C6H4BrF2NPurity:98%Color and Shape:SolidMolecular weight:208.00353-Bromo-2,4-difluoroaniline
CAS:Formula:C6H4BrF2NPurity:97%Color and Shape:SolidMolecular weight:208.0063-Bromo-2,4-difluoroaniline
CAS:3-Bromo-2,4-difluoroanilineFormula:C6H4BrF2NPurity:98%Molecular weight:208.03-Bromo-2,4-difluoroaniline
CAS:3-Bromo-2,4-difluoroaniline is a fluoroquinolone that inhibits the DNA gyrase and topoisomerase IV, which are enzymes that maintain the integrity of bacterial DNA. It binds to bacterial 16S ribosomal RNA and inhibits protein synthesis, leading to cell death by inhibiting the production of proteins vital for cell division. 3-Bromo-2,4-difluoroaniline has been shown to be effective against methicillin-resistant Staphylococcus aureus (MRSA) and Clostridium perfringens, although is not active against acid-fast bacteria such as Mycobacterium tuberculosis or Mycobacterium avium complex.Formula:C6H4BrF2NPurity:Min. 95%Molecular weight:208.01 g/mol




