CymitQuimica logo

CAS 1039775-34-2

:

9H-Fluorene-2-sulfonic acid, 9-(dicyclohexylphosphino)-9-[3-(4-sulfophenyl)propyl]-, sulfate (1:1)

Description:
9H-Fluorene-2-sulfonic acid, 9-(dicyclohexylphosphino)-9-[3-(4-sulfophenyl)propyl]-, sulfate (1:1) is a complex organic compound characterized by its unique structural features, which include a fluorene backbone and a sulfonic acid functional group. This compound typically exhibits properties associated with both organic and inorganic chemistry due to the presence of phosphine and sulfonate groups. It is likely to be soluble in polar solvents, given the sulfonic acid moiety, which enhances its hydrophilicity. The dicyclohexylphosphino group may impart specific reactivity and coordination properties, making it useful in catalysis or as a ligand in coordination chemistry. Additionally, the presence of the sulfate group suggests potential applications in various fields, including pharmaceuticals and materials science. Its molecular structure may also influence its electronic properties, making it a candidate for studies in organic electronics or photonics. Overall, this compound's characteristics make it a subject of interest in both synthetic and applied chemistry contexts.
Formula:C34H41O6PS2·H2O4S
InChI:InChI=1S/C34H41O6PS2.H2O4S/c35-42(36,37)28-19-17-25(18-20-28)10-9-23-34(41(26-11-3-1-4-12-26)27-13-5-2-6-14-27)32-16-8-7-15-30(32)31-22-21-29(24-33(31)34)43(38,39)40;1-5(2,3)4/h7-8,15-22,24,26-27H,1-6,9-14,23H2,(H,35,36,37)(H,38,39,40);(H2,1,2,3,4)
InChI key:InChIKey=HNJNDGZFLWQSEG-UHFFFAOYSA-N
SMILES:P(C1(CCCC2=CC=C(S(=O)(=O)O)C=C2)C=3C(C=4C1=CC=CC4)=CC=C(S(=O)(=O)O)C3)(C5CCCCC5)C6CCCCC6.S(=O)(=O)(O)O
Synonyms:
  • CataCXium F sulf
  • 9H-Fluorene-2-sulfonic acid, 9-(dicyclohexylphosphino)-9-[3-(4-sulfophenyl)propyl]-, sulfate (1:1)
Found 2 products.