CymitQuimica logo

CAS 103986-01-2

:

4-methoxy-b-oxo-Benzenebutanenitrile

Description:
4-Methoxy-β-oxo-benzenebutanenitrile, identified by its CAS number 103986-01-2, is an organic compound that features a methoxy group and a nitrile functional group, contributing to its chemical reactivity and properties. This compound typically exhibits a crystalline solid form and is characterized by its aromatic structure, which enhances stability and influences its solubility in various organic solvents. The presence of the β-oxo group indicates that it may participate in various chemical reactions, such as nucleophilic additions or condensation reactions. The methoxy group can also affect the electronic properties of the molecule, potentially influencing its reactivity and interaction with other chemical species. Additionally, the nitrile group is known for its ability to participate in further chemical transformations, making this compound of interest in synthetic organic chemistry. Overall, 4-methoxy-β-oxo-benzenebutanenitrile is a versatile compound with potential applications in pharmaceuticals, agrochemicals, and materials science, depending on its specific reactivity and functionalization.
Formula:C11H11NO2
InChI:InChI=1S/C11H11NO2/c1-14-11-4-2-9(3-5-11)8-10(13)6-7-12/h2-5H,6,8H2,1H3
InChI key:DUJOBEUGRQXMHS-UHFFFAOYSA-N
SMILES:COC1=CC=C(C=C1)CC(=O)CC#N
Synonyms:
  • Benzenebutanenitrile, 4-methoxy-b-oxo-
Found 2 products.