CymitQuimica logo

CAS 103987-28-6

:

2,3-dimethyl-1H-indole-7-carbaldehyde

Description:
2,3-Dimethyl-1H-indole-7-carbaldehyde is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This specific compound features two methyl groups at the 2 and 3 positions of the indole ring and an aldehyde functional group at the 7 position. The presence of the aldehyde group contributes to its reactivity, making it a potential candidate for various chemical reactions, including condensation and oxidation. It is typically a yellow to brown solid at room temperature and is soluble in organic solvents such as ethanol and dichloromethane. The compound may exhibit biological activity, making it of interest in medicinal chemistry and research. Its unique structure allows for potential applications in the synthesis of more complex molecules, particularly in the development of pharmaceuticals or agrochemicals. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C11H11NO
InChI:InChI=1/C11H11NO/c1-7-8(2)12-11-9(6-13)4-3-5-10(7)11/h3-6,12H,1-2H3
SMILES:Cc1c(C)[nH]c2c(cccc12)C=O
Found 1 products.