CymitQuimica logo

CAS 103987-81-1

:

8-ETHYNYLQUINOLINE

Description:
8-Ethynylquinoline is an organic compound characterized by the presence of a quinoline ring substituted with an ethynyl group at the 8-position. This compound typically exhibits a pale yellow to brownish appearance and is known for its aromatic properties due to the conjugated system of the quinoline structure. It is a heterocyclic compound, which means it contains atoms of at least two different elements in its ring structure, in this case, nitrogen and carbon. 8-Ethynylquinoline is often utilized in organic synthesis and may serve as a precursor for various chemical reactions, including those involving coordination chemistry and the development of fluorescent materials. Its unique structure allows for potential applications in medicinal chemistry, particularly in the design of pharmaceuticals, as well as in materials science for the development of sensors or light-emitting devices. The compound's reactivity can be influenced by the presence of the ethynyl group, which can participate in further chemical transformations. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C11H7N
InChI:InChI=1S/C11H7N/c1-2-9-5-3-6-10-7-4-8-12-11(9)10/h1,3-8H
InChI key:PBKFDEMENCIDDQ-UHFFFAOYSA-N
SMILES:C#CC1=CC=CC2=C1N=CC=C2
Found 4 products.