CymitQuimica logo

CAS 1039915-79-1

:

5-[4-(1-Oxopropyl)phenoxy]pentanoic acid

Description:
5-[4-(1-Oxopropyl)phenoxy]pentanoic acid, identified by its CAS number 1039915-79-1, is an organic compound characterized by its unique molecular structure that includes a pentanoic acid backbone and a phenoxy group substituted with a propanoyl moiety. This compound typically exhibits properties associated with both carboxylic acids and aromatic compounds, such as solubility in organic solvents and potential reactivity due to the presence of the carboxylic acid functional group. The phenoxy group may impart specific biological activities or interactions, making it of interest in pharmaceutical or agrochemical applications. Additionally, the presence of the carbonyl group in the propanoyl side chain can influence its chemical reactivity and stability. Overall, this compound's characteristics suggest it may play a role in various chemical reactions or applications, particularly in fields that explore the synthesis of bioactive molecules or materials. Further studies would be necessary to elucidate its specific properties and potential uses in various scientific domains.
Formula:C14H18O4
InChI:InChI=1S/C14H18O4/c1-2-13(15)11-6-8-12(9-7-11)18-10-4-3-5-14(16)17/h6-9H,2-5,10H2,1H3,(H,16,17)
InChI key:InChIKey=CNCXTAFWDQHHGT-UHFFFAOYSA-N
SMILES:C(CC)(=O)C1=CC=C(OCCCCC(O)=O)C=C1
Synonyms:
  • 5-[4-(1-Oxopropyl)phenoxy]pentanoic acid
  • Pentanoic acid, 5-[4-(1-oxopropyl)phenoxy]-
Found 1 products.