CAS 103994-00-9
:ACETYL AF-64
Description:
Acetyl AF-64, with the CAS number 103994-00-9, is a chemical compound primarily used in research and industrial applications. It is known for its role as a reagent in organic synthesis and may serve as an acetylating agent. The compound typically exhibits characteristics such as being a colorless to pale yellow liquid, with a distinctive odor. It is soluble in organic solvents, which makes it useful in various chemical reactions. Acetyl AF-64 is often handled with care due to its potential reactivity and the need for appropriate safety measures, as it may pose health risks upon exposure. Its applications can extend to the fields of pharmaceuticals, agrochemicals, and polymer chemistry, where it may be involved in modifying molecular structures or enhancing the properties of other compounds. As with any chemical substance, proper handling, storage, and disposal according to safety guidelines are essential to mitigate any hazards associated with its use.
Formula:C8H17Cl2NO2
InChI:InChI=1/C8H16ClNO2.ClH/c1-3-10(5-4-9)6-7-12-8(2)11;/h3-7H2,1-2H3;1H
SMILES:CCN(CCCl)CCOC(=O)C.Cl
Synonyms:- Acetylethylcholine Mustard Hydrochloride
- 2-[(2-Chloroethyl)(Ethyl)Amino]Ethyl Acetate Hydrochloride (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-((2-chloroethyl)(ethyl)amino)ethyl acetate hydrochloride
CAS:2-((2-chloroethyl)(ethyl)amino)ethyl acetate hydrochlorideFormula:C8H17Cl2NO2Purity:≥90%Molecular weight:230.13Acetylethylcholine mustard hydrochloride
CAS:Acetylethylcholine mustard hydrochloride is a choline acetyl-transferase inhibitor that decreases muscle contraction frequency by inhibiting the synthesis of acetyl-beta-methylcholine (Ach), with a half-maximal inhibitory concentration (IC50) of 1.22 mM. It serves as an irreversible ligand for the high-affinity choline transport system and functions as a specific presynaptic long-acting cholinergic toxin. Additionally, acetylethylcholine mustard hydrochloride is a precursor to the ethylcholine mustard aziridinium ion.Formula:C8H17Cl2NO2Molecular weight:230.132



