CymitQuimica logo

CAS 103999-77-5

:

2,5-Dichloro-3-fluoropyridine

Description:
2,5-Dichloro-3-fluoropyridine is a heterocyclic aromatic compound characterized by a pyridine ring substituted with two chlorine atoms and one fluorine atom. Its molecular formula is C5H3Cl2F N, indicating the presence of five carbon atoms, three hydrogen atoms, two chlorine atoms, one fluorine atom, and one nitrogen atom. This compound typically appears as a colorless to pale yellow liquid or solid, depending on temperature and purity. It is known for its role in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The presence of halogen substituents enhances its reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, 2,5-Dichloro-3-fluoropyridine exhibits moderate to low solubility in water but is more soluble in organic solvents. Safety precautions should be taken when handling this compound, as it may pose health risks, including irritation to the skin and respiratory system. Proper storage and disposal methods are essential to mitigate environmental impact.
Formula:C5H2Cl2FN
InChI:InChI=1/C5H2Cl2FN/c6-3-1-4(8)5(7)9-2-3/h1-2H
InChI key:UMURTAGJSLLLMZ-UHFFFAOYSA-N
SMILES:c1c(cnc(c1F)Cl)Cl
Synonyms:
  • Pyridine, 2,5-dichloro-3-fluoro-
Found 3 products.