CAS 104-16-5
:1-(3-Chloropropyl)-4-methylpiperazine
Description:
1-(3-Chloropropyl)-4-methylpiperazine is an organic compound characterized by its piperazine ring structure, which is a six-membered ring containing two nitrogen atoms at opposite positions. This compound features a chloropropyl group attached to one nitrogen atom and a methyl group attached to the fourth position of the piperazine ring. It is typically a colorless to pale yellow liquid with a distinctive amine-like odor. The presence of the chlorine atom and the alkyl substituents contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The compound is soluble in water and organic solvents, which enhances its utility in chemical synthesis and formulation processes. As with many piperazine derivatives, it may exhibit biological activity, making it of interest in medicinal chemistry. Safety precautions should be taken when handling this substance, as it may pose health risks, including irritation to the skin and respiratory system. Proper storage and disposal methods are essential to mitigate environmental impact.
Formula:C8H17ClN2
InChI:InChI=1S/C8H17ClN2/c1-10-5-7-11(8-6-10)4-2-3-9/h2-8H2,1H3
InChI key:InChIKey=AUERUDPETOKUPT-UHFFFAOYSA-N
SMILES:C(CCCl)N1CCN(C)CC1
Synonyms:- 1-(3-Chloropropyl)-4-methylpiperazine
- 1-Chloro-3-(4-methyl-1-piperazinyl)propane
- 1-Methyl-4-(3-chloropropyl)piperazine
- 3-(4-Methyl-1-piperazinyl)propyl chloride
- 3-(4-Methylpiperazino)propyl chloride
- N-(3-Chloropropyl)-N′-methylpiperazine
- N-Methylpiperazinopropyl chloride
- Piperazine, 1-(3-chloropropyl)-4-methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-(3-Chloropropyl)-4-methylpiperazine
CAS:Formula:C8H17ClN2Purity:98%Color and Shape:SolidMolecular weight:176.68701-(3-Chloroprop-1-yl)-4-methylpiperazine
CAS:1-(3-Chloroprop-1-yl)-4-methylpiperazineFormula:C8H17ClN2Purity:95%Color and Shape:Pale yellow LiquidMolecular weight:176.686981-(3-Chloropropyl)-4-methylpiperazine
CAS:1-(3-Chloropropyl)-4-methylpiperazine is an analog of chlorpromazine. It has been shown to be a transactivator, which causes the activation of genes in response to a variety of stimuli and plays a role in the pathogenesis of infections. 1-(3-Chloropropyl)-4-methylpiperazine also interacts with chloride ions, causing an increase in intracellular chloride concentrations. This increased concentration leads to an increase in transcription and replication rates. The structures of viral RNA were determined using 1-(3-chloropropyl)-4-methylpiperazine as a fluorescent probe.Formula:C8H17ClN2Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:176.69 g/mol1-(3-Chloropropyl)-4-methylpiperazine
CAS:1-(3-Chloropropyl)-4-methylpiperazineFormula:C8H17ClN2Purity:98%Molecular weight:176.691-(3-Chloropropyl)-4-methylpiperazine
CAS:Formula:C8H17ClN2Purity:98%Color and Shape:LiquidMolecular weight:176.69




