CAS 104-18-7
:2-[(4-Aminophenyl)thio]acetic acid
Description:
2-[(4-Aminophenyl)thio]acetic acid, also known by its CAS number 104-18-7, is an organic compound characterized by the presence of both an amino group and a thiol group attached to an acetic acid backbone. This compound features a thioether linkage, where a sulfur atom is bonded to a phenyl ring substituted with an amino group, contributing to its unique chemical properties. It typically appears as a solid at room temperature and is soluble in polar solvents due to the presence of the carboxylic acid functional group. The amino group can participate in hydrogen bonding, enhancing its solubility in water. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its structure allows for potential interactions with various biological targets, which could lead to applications in medicinal chemistry. Additionally, the presence of both the amino and carboxylic acid functional groups suggests that it may act as a zwitterion under certain conditions, influencing its reactivity and interaction with other molecules.
Formula:C8H9NO2S
InChI:InChI=1S/C8H9NO2S/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5,9H2,(H,10,11)
InChI key:InChIKey=CTPIHHXCACYCIV-UHFFFAOYSA-N
SMILES:S(CC(O)=O)C1=CC=C(N)C=C1
Synonyms:- (4-Aminophenylsulfanyl)ethanoic acid
- 2-(4-Aminophenylthio)acetic acid
- 2-[(4-Aminophenyl)sulfanyl]acetic acid
- 2-[(4-Aminophenyl)thio]acetic acid
- 4-Aminophenylmercaptoacetic acid
- 4-Aminophenylthioacetic acid
- 4-Aminothiophenoxyacetic acid
- Acetic acid, 2-[(4-aminophenyl)thio]-
- Acetic acid, [(4-aminophenyl)thio]-
- Acetic acid, [(p-aminophenyl)thio]-
- NSC 125376
- NSC 43555
- [(4-Aminophenyl)Sulfanyl]Acetate
- [(4-Aminophenyl)Sulfanyl]Acetic Acid
- [(p-Aminophenyl)thio]acetic acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
S-(4-Aminophenyl)thioglycolic acid
CAS:S-(4-Aminophenyl)thioglycolic acidFormula:C8H9NO2SPurity:97%Color and Shape:SolidMolecular weight:183.227562-((4-Aminophenyl)thio)acetic acid
CAS:Formula:C8H9NO2SPurity:97%Color and Shape:SolidMolecular weight:183.22762-(4-Aminophenylthio)acetic Acid
CAS:Controlled ProductFormula:C8H9NO2SColor and Shape:NeatMolecular weight:183.232-((4-Aminophenyl)thio)acetic acid
CAS:Purity:97%(HPLC);RGColor and Shape:SolidMolecular weight:183.22999572-(4-Aminophenylthio)acetic acid
CAS:2-(4-Aminophenylthio)acetic acid is an analytical reagent that is used for the determination of nitrite ion. It reacts with nitrous acid to form a red-colored dye. 2-(4-Aminophenylthio)acetic acid has been shown to be an effective anhydrase inhibitor, which can be used in analytical chemistry as a method for determining the concentration of nitrate ion. This compound also has a constant value of 1.5, which can be used to calculate the concentration of nitric acid in hydrochloric acid by using the following equation: 2 NaOH + HCl → NaCl + 2 H2O 1.5 (aq) + 4H+(aq) → 6H2O(l) 6H2O(l) ÷ 1.5 (mol/L) = 3 mol/L 3 mol/L ÷ 0.037 (mol/g) =Formula:C8H9NO2SPurity:Min. 95%Molecular weight:183.23 g/mol






