CymitQuimica logo

CAS 104007-26-3

:

3-ethoxy-2-(methylsulfonyl)acrylonitrile

Description:
3-Ethoxy-2-(methylsulfonyl)acrylonitrile is an organic compound characterized by its unique functional groups, including an ethoxy group, a methylsulfonyl group, and a nitrile group. This compound features a double bond characteristic of acrylonitrile derivatives, which contributes to its reactivity and potential applications in organic synthesis. The presence of the ethoxy group enhances its solubility in organic solvents, while the methylsulfonyl group can influence its polarity and reactivity, making it a versatile intermediate in chemical reactions. The nitrile functional group is known for its ability to participate in nucleophilic addition reactions, which can be exploited in various synthetic pathways. Additionally, the compound may exhibit specific physical properties such as boiling and melting points, which are influenced by its molecular structure and intermolecular interactions. Overall, 3-ethoxy-2-(methylsulfonyl)acrylonitrile is a valuable compound in the field of organic chemistry, particularly in the development of pharmaceuticals and agrochemicals.
Formula:C6H9NO3S
InChI:InChI=1S/C6H9NO3S/c1-3-10-5-6(4-7)11(2,8)9/h5H,3H2,1-2H3
InChI key:IVOPUQQPAOLLSH-UHFFFAOYSA-N
SMILES:CCOC=C(C#N)S(=O)(=O)C
Found 1 products.