CAS 104030-54-8: CARPROPAMID

Description:Carpropamid, with the CAS number 104030-54-8, is a chemical compound primarily recognized for its application as a plant growth regulator. It belongs to the class of substances known as amides and is characterized by its ability to influence plant growth processes, particularly in promoting root development and enhancing overall plant vigor. Carpropamid is typically used in agricultural settings to improve crop yield and quality. The compound exhibits low toxicity to humans and animals, making it a safer alternative compared to some traditional agrochemicals. Its mode of action involves the modulation of plant hormone levels, particularly auxins, which are crucial for various growth responses. Additionally, carpropamid is soluble in organic solvents, which facilitates its application in various formulations. As with many agrochemicals, proper handling and adherence to safety guidelines are essential to mitigate any potential environmental impact. Overall, carpropamid represents a valuable tool in modern agriculture, contributing to sustainable farming practices.

Formula:C₁₅H₁₈Cl₃NO

InChI:InChI=1S/C15H18Cl3NO/c1-4-14(10(3)15(14,17)18)13(20)19-9(2)11-5-7-12(16)8-6-11/h5-10H,4H2,1-3H3,(H,19,20)

InChI key:InChIKey=RXDMAYSSBPYBFW-UHFFFAOYSA-N

SMILES:O=C(NC(C1=CC=C(Cl)C=C1)C)C2(CC)C(C)C2(Cl)Cl

Synonyms:
2,2-dichloro-N-[1-(4-chlorophenyl)ethyl]-1-ethyl-3-methylcyclopropanecarboxamide
Carpropamid (Bsi,Paiso)
Carpropamid 97 %
Carpropamid Standard
Carpropamide
Cyclopropanecarboxamide, 2,2-dichloro-N-[1-(4-chlorophenyl)ethyl]-1-ethyl-3-methyl-
Ktu 3616
Protiga

Found 3 products.

Product data	Purity	Price range	Estimated delivery
Carpropamid REF: 04-C11045900CAS: 104030-54-8	- - -	111.00 €	Thu 06 Mar 25
Carpropamide REF: TR-C184363CAS: 104030-54-8	- - -	110.00 €~241.00 €	Thu 13 Mar 25
Carpropamide REF: 3D-EEA03054CAS: 104030-54-8	Min. 95%	To inquire	Mon 14 Apr 25