CymitQuimica logo

CAS 104048-92-2

:

4-(trifluoromethyl)-2-pyrimidinol

Description:
4-(Trifluoromethyl)-2-pyrimidinol is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered heterocyclic aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a trifluoromethyl group (-CF3) at the 4-position significantly influences its chemical properties, enhancing its lipophilicity and potentially its biological activity. This compound typically exhibits polar characteristics due to the hydroxyl (-OH) group at the 2-position, which can participate in hydrogen bonding. It is often utilized in medicinal chemistry and pharmaceutical research due to its potential as a building block for various bioactive molecules. The trifluoromethyl group can also impart unique electronic properties, making it a valuable moiety in drug design. Additionally, 4-(trifluoromethyl)-2-pyrimidinol may exhibit stability under various conditions, although specific reactivity can depend on the surrounding functional groups and the overall molecular environment. Its applications may extend to agrochemicals and materials science, reflecting its versatility in synthetic chemistry.
Formula:C5H3F3N2O
InChI:InChI=1/C5H3F3N2O/c6-5(7,8)3-1-2-9-4(11)10-3/h1-2H,(H,9,10,11)
InChI key:WCEBFEVZTGLOHC-UHFFFAOYSA-N
SMILES:c1cnc(nc1C(F)(F)F)O
Synonyms:
  • 2-Hydroxy-4-(trifluoromethyl)pyrimidine
  • 4-Trifluoromethyl-2-Hydroxypyrimidine
  • 2-Hydroxy-4-trifluoromethylpyrimidine
  • 4-(Trifluoromethyl)Pyrimidin-2-Ol
Found 5 products.