CAS 104075-48-1: 1H-Imidazole, 5-(2-ethyl-2,3-dihydro-1H-inden-2-yl)-, hydrochloride (1:1)
Description:1H-Imidazole, 5-(2-ethyl-2,3-dihydro-1H-inden-2-yl)-, hydrochloride (1:1), with CAS number 104075-48-1, is a chemical compound characterized by its imidazole core, which is a five-membered aromatic ring containing two nitrogen atoms. This compound features a substituent at the 5-position, specifically a 2-ethyl-2,3-dihydro-1H-inden-2-yl group, contributing to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals. The presence of the imidazole moiety suggests potential interactions with biological systems, possibly acting as a ligand or influencing enzyme activity. The compound's structure may also indicate potential uses in medicinal chemistry, particularly in the development of drugs targeting specific receptors or pathways. Overall, its characteristics make it a compound of interest in both research and application within the fields of organic and medicinal chemistry.
Formula:C14H16N2·ClH
InChI:InChI=1S/C14H16N2.ClH/c1-2-14(13-9-15-10-16-13)7-11-5-3-4-6-12(11)8-14;/h3-6,9-10H,2,7-8H2,1H3,(H,15,16);1H
InChI key:InChIKey=PCCVCJAQMHDWJY-UHFFFAOYSA-N
SMILES:Cl.N1=CNC(=C1)C2(CC=3C=CC=CC3C2)CC
- Synonyms:
- 1H-Imidazole, 5-(2-ethyl-2,3-dihydro-1H-inden-2-yl)-, hydrochloride (1:1)
- 5-(2-ethyl-2,3-dihydro-1H-inden-2-yl)-1H-imidazole hydrochloride (1:1)
- Antisedan
- Atipamezole HCL
- Atipamezole hydrochloride
- 1H-Imidazole, 4-(2-ethyl-2,3-dihydro-1H-inden-2-yl)-, monohydrochloride