CymitQuimica logo

CAS 104097-35-0

:

(Naphthalen-2-yloxy)-acetonitrile

Description:
(Naphthalen-2-yloxy)-acetonitrile, with the CAS number 104097-35-0, is an organic compound characterized by its unique structure, which features a naphthalene ring substituted with an ether linkage to an acetonitrile group. This compound typically exhibits properties common to aromatic compounds, such as stability and relatively low reactivity under standard conditions. It is likely to be a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. The presence of the acetonitrile moiety suggests that it may have polar characteristics, which can influence its solubility in various solvents. Additionally, the naphthalene component may impart certain aromatic properties, making it useful in various chemical applications, including synthesis and as an intermediate in organic reactions. Safety data should be consulted for handling and storage, as compounds of this nature can pose health risks if not managed properly. Overall, (Naphthalen-2-yloxy)-acetonitrile is a compound of interest in organic chemistry and materials science.
Formula:C12H9NO
InChI:InChI=1/C12H9NO/c13-7-8-14-12-6-5-10-3-1-2-4-11(10)9-12/h1-6,9H,8H2
InChI key:YVRXIVWRURPCRV-UHFFFAOYSA-N
SMILES:c1ccc2cc(ccc2c1)OCC#N
Synonyms:
  • (2-Naphthyloxy)acetonitrile
  • Acetonitrile, 2-(2-naphthalenyloxy)-
Found 4 products.