CAS 104104-50-9
:Gabazine
Description:
Gabazine, also known as SR-95531, is a chemical compound primarily recognized as a selective antagonist of the GABA_A receptor, which plays a crucial role in inhibitory neurotransmission in the central nervous system. Its chemical structure features a bicyclic framework, contributing to its pharmacological properties. Gabazine is often utilized in neuroscience research to study the effects of GABAergic inhibition and to explore the mechanisms underlying various neurological conditions. The compound is known for its ability to block the action of GABA, thereby facilitating the examination of excitatory neurotransmission and synaptic plasticity. Gabazine is typically administered in experimental settings and is not approved for clinical use in humans. Its effects can vary based on concentration and the specific neuronal environment, making it a valuable tool for understanding the complexities of neurotransmitter interactions. Safety and handling precautions are essential when working with Gabazine, as with any chemical compound, to mitigate potential risks associated with its use in laboratory settings.
Formula:C15H17N3O3·BrH
InChI:InChI=1S/C15H17N3O3.BrH/c1-21-12-6-4-11(5-7-12)13-8-9-14(16)18(17-13)10-2-3-15(19)20;/h4-9,16H,2-3,10H2,1H3,(H,19,20);1H
InChI key:InChIKey=GFZHNFOGCMEYTA-UHFFFAOYSA-N
SMILES:C(CCC(O)=O)N1N=C(C=CC1=N)C2=CC=C(OC)C=C2.Br
Synonyms:- 1(6H)-Pyridazinebutanoic acid, 6-imino-3-(4-methoxyphenyl)-, hydrobromide (1:1)
- 1(6H)-Pyridazinebutanoic acid, 6-imino-3-(4-methoxyphenyl)-, monohydrobromide
- Gabazine
- SR 95531
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Ref: IN-DA008SG4
1gTo inquire250mgTo inquire1mg72.00€10mg128.00€5mg155.00€25mg280.00€50mg296.00€100mg616.00€2-(3-Carboxypropyl)-3-Amino-6-(4-Methoxyphenyl)Pyridazinium Bromide
CAS:2-(3-Carboxypropyl)-3-Amino-6-(4-Methoxyphenyl)Pyridazinium BromideFormula:C15H18BrN3O3Purity:≥98%Molecular weight:368.23Gabazine
CAS:Gabazine (SR95531) is an antagonist of GABAA receptors (Ki : 74-150 nM)Formula:C15H18BrN3O3Purity:98.51% - 99.24%Color and Shape:White SolidMolecular weight:368.23Gabazine
CAS:4-(6-Imino-3-(4-methoxyphenyl)pyridazin-1(6H)-yl)butanoic acid hydrobromideFormula:C15H18BrN3O3Purity:95+%Molecular weight:368.23SR 95531 hydrobromide
CAS:GABAA receptor antagonist that displaces [3H]-GABA in membranes of rat brain (Ki value 0.15 µM). Has greater affinity for GABAA than bicuculline (20-fold greater). Inhibits Cl- current induced by GABA, but not pentobarbitone. Low-affinity inhibitor of glycine receptors.Formula:C15H17N3O3·HBrPurity:Min. 95%Color and Shape:PowderMolecular weight:368.23 g/molGabazine Hydrobromide
CAS:Controlled ProductFormula:C15H17N3O3·HBrColor and Shape:NeatMolecular weight:368.22





