CymitQuimica logo

CAS 104147-32-2

:

3,5-Dichloro-4-(1,1,2,2-tetrafluoroethoxy)benzenamine

Description:
3,5-Dichloro-4-(1,1,2,2-tetrafluoroethoxy)benzenamine, with the CAS number 104147-32-2, is an organic compound characterized by its aromatic amine structure. It features a benzene ring substituted with two chlorine atoms at the 3 and 5 positions and an ether group containing a tetrafluoroethane moiety at the para position relative to the amine group. This compound is notable for its fluorinated side chain, which can impart unique chemical properties such as increased hydrophobicity and thermal stability. The presence of chlorine atoms contributes to its reactivity and potential applications in various chemical syntheses. As an amine, it may participate in nucleophilic substitution reactions and can serve as a building block in the synthesis of more complex organic molecules. Additionally, the fluorinated group may enhance its performance in specific applications, such as in agrochemicals or pharmaceuticals. Safety and handling precautions are essential due to the potential toxicity associated with chlorinated and fluorinated compounds.
Formula:C8H5Cl2F4NO
InChI:InChI=1S/C8H5Cl2F4NO/c9-4-1-3(15)2-5(10)6(4)16-8(13,14)7(11)12/h1-2,7H,15H2
InChI key:InChIKey=JIPDPVQPKLVDIU-UHFFFAOYSA-N
SMILES:O(C(C(F)F)(F)F)C1=C(Cl)C=C(N)C=C1Cl
Synonyms:
  • Benzenamine, 3,5-dichloro-4-(1,1,2,2-tetrafluoroethoxy)-
  • 3,5-Dichloro-4-(1,1,2,2-tetrafluoroethoxy)aniline
  • 3,5-Dichloro-4-(1,1,2,2-tetrafluoroethoxy)benzenamine
Found 4 products.