CymitQuimica logo

CAS 10420-20-9

:

9H-Carbazole, 9-(4-bromobutyl)-

Description:
9H-Carbazole, 9-(4-bromobutyl)- is an organic compound characterized by its structure, which consists of a carbazole moiety substituted with a 4-bromobutyl group. The presence of the bromobutyl substituent introduces both hydrophobic and polar characteristics, influencing its solubility and reactivity. This compound typically exhibits a solid state at room temperature and may have a moderate melting point. Its molecular structure allows for potential applications in organic electronics, such as in light-emitting diodes (LEDs) and organic photovoltaics, due to the electronic properties imparted by the carbazole unit. Additionally, the bromine atom can serve as a site for further chemical modifications, making it a versatile intermediate in synthetic chemistry. The compound's reactivity may also be influenced by the presence of the bromine atom, which can participate in nucleophilic substitution reactions. Overall, 9H-Carbazole, 9-(4-bromobutyl)- is a notable compound in the field of organic synthesis and materials science.
Formula:C16H16BrN
InChI:InChI=1S/C16H16BrN/c17-11-5-6-12-18-15-9-3-1-7-13(15)14-8-2-4-10-16(14)18/h1-4,7-10H,5-6,11-12H2
InChI key:IXCQFUSWIBGIQG-UHFFFAOYSA-N
SMILES:C1=CC=C2C(=C1)C3=CC=CC=C3N2CCCCBr
Found 3 products.