CymitQuimica logo

CAS 1042224-77-0

:

tert-butyl4-(6-bromopyridin-2-ylamino)piperidine-1-carboxylate

Description:
Tert-butyl 4-(6-bromopyridin-2-ylamino)piperidine-1-carboxylate is a chemical compound characterized by its complex structure, which includes a piperidine ring, a tert-butyl ester group, and a brominated pyridine moiety. This compound typically exhibits properties associated with both amines and esters, such as moderate solubility in organic solvents and potential reactivity due to the presence of the bromine atom, which can participate in nucleophilic substitution reactions. The piperidine ring contributes to its basicity, while the tert-butyl group enhances its lipophilicity, making it suitable for various applications in medicinal chemistry and drug development. The presence of the bromopyridine fragment may also impart specific biological activities, making this compound of interest in the synthesis of pharmaceuticals. Additionally, its molecular structure suggests potential for interactions with biological targets, which could be explored in further research. Overall, this compound exemplifies the intricate balance of structural features that can influence both chemical reactivity and biological activity.
Formula:C15H22BrN3O2
InChI:InChI=1S/C15H22BrN3O2/c1-15(2,3)21-14(20)19-9-7-11(8-10-19)17-13-6-4-5-12(16)18-13/h4-6,11H,7-10H2,1-3H3,(H,17,18)
InChI key:YLDMRRWJDKSWFZ-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC(CC1)NC2=NC(=CC=C2)Br
Found 4 products.